A1338412
1-Bromo-2,6-difluorobenzene , 98% , 64248-56-2
CAS NO.:64248-56-2
Empirical Formula: C6H3BrF2
Molecular Weight: 192.99
MDL number: MFCD00009894
EINECS: 264-750-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB104.00 | In Stock |
|
| 100G | RMB356.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20 °C |
| Boiling point: | 61 °C (35 mmHg) |
| Density | 1.71 |
| refractive index | n |
| Flash point: | 128 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | Liquid |
| color | Clear yellow |
| BRN | 1681053 |
| InChI | InChI=1S/C6H3BrF2/c7-6-4(8)2-1-3-5(6)9/h1-3H |
| InChIKey | HRZTZLCMURHWFY-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1Br |
| CAS DataBase Reference | 64248-56-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-bromo-1,3-difluoro-(64248-56-2) |
Description and Uses
1-Bromo-2,6-difluorobenzene has been used in the synthesis of tris(fluorophenyl)boranes.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







