A1341712
4-Bromo-2-methylpyridine , 98% , 22282-99-1
CAS NO.：22282-99-1
Empirical Formula: C6H6BrN
Molecular Weight: 172.02
MDL number: MFCD03788196
EINECS: 624-896-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB325.60 | In Stock |
|
| 100G | RMB1300.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-27° |
| Boiling point: | 76 °C / 14mmHg |
| Density | 1.450 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 174 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Dichloromethane |
| form | Pale Yellow Liquid |
| pka | 4.38±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Miscible with dichloromethane. Immiscible with water. |
| InChI | InChI=1S/C6H6BrN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3 |
| InChIKey | JFBMFWHEXBLFCR-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC(Br)=C1 |
| CAS DataBase Reference | 22282-99-1(CAS DataBase Reference) |
Description and Uses
4-Bromo-2-methylpyridine is a starting material used in a synthesis of crown-ester-bipyridines and viologens via sodium or nickel reductive coupling, side chain oxidation and esterification.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-36/39-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
