A1348150
4'-Chlorobiphenyl-4-carbaldehyde , ≥98% , 80565-30-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB119.20 | In Stock |
|
| 1g | RMB284.00 | In Stock |
|
| 5g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-118°C |
| Boiling point: | 354.3±25.0 °C(Predicted) |
| Density | 1.214±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | Solid |
| color | Pale Yellow |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C13H9ClO/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-9H |
| InChIKey | UXCMNUUPBMYDLJ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(Cl)C=C2)=CC=C(C=O)C=C1 |
| CAS DataBase Reference | 80565-30-6(CAS DataBase Reference) |
Description and Uses
4''-Chlorobiphenyl-4-carbaldehyde is used in the synthesis of thieno[3,2-d]pyrimidines as scaffold of antimicrobial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2913000090 |
