A1348212
(2S,3S)-(-)-Bis(diphenylphosphino)butane , 97% , 64896-28-2
Synonym(s):
(S,S)-Chiraphos;(2S,3S)-(−)-2,3-Bis(diphenylphosphino)butane
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB207.20 | In Stock |
|
| 100MG | RMB375.20 | In Stock |
|
| 250MG | RMB799.20 | In Stock |
|
| 1G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-109 °C |
| alpha | D27 -211° (c = 1.5 in CHCl3) |
| Boiling point: | 529.2±33.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Acetonitrile, Chloroform |
| form | crystal |
| color | white |
| optical activity | [α]22/D 191°, c = 1.5 in chloroform |
| Sensitive | Air Sensitive |
| Merck | 14,2063 |
| BRN | 4268869 |
| InChI | InChI=1/C28H28P2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/s3 |
| InChIKey | FWXAUDSWDBGCMN-DPVGMKQNNA-N |
| SMILES | P([C@@H](C)[C@H](C)P(C1C=CC=CC=1)C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 |&1:1,3,r| |
| CAS DataBase Reference | 64896-28-2(CAS DataBase Reference) |
Description and Uses
(2S,3S)-(-)-Bis(diphenylphosphino)butane, also known as (S,S)-Chiraphos, is a chiral ligand used in the preparation of bimetallic chromium and diphosphine-ruthenium (II) diallyl complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![(1R,4S,5S,6S)-5,6-Bis(diphenylphosphaneyl)bicyclo[2.2.1]hept-2-ene](https://img.chemicalbook.com/CAS/GIF/71042-54-1.gif)

