A1358912
N-Boc-cis-4-N-Fmoc-amino-L-proline , 97% , 174148-03-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB513.36 | In Stock |
|
| 5G | RMB1468.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-154 °C(lit.) |
| Boiling point: | 650.2±55.0 °C(Predicted) |
| Density | 1.33 |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.81±0.40(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D -68°, c = 1 in chloroform |
| InChIKey | UPXRTVAIJMUAQR-BTYIYWSLSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C[C@H]1C(O)=O |
Description and Uses
also available as trans isomer, see 1-00972
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29242990 |
