A1359112
3-Bromostyrene , > 96.0%(GC), containing 0.1%TBC stabilizer , 2039-86-3
Synonym(s):
1-Bromo-3-ethenylbenzene;1-Bromo-3-vinylbenzene
CAS NO.:2039-86-3
Empirical Formula: C8H7Br
Molecular Weight: 183.05
MDL number: MFCD00000088
EINECS: 218-025-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB200.80 | In Stock |
|
| 25G | RMB792.00 | In Stock |
|
| 100G | RMB2229.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 74-75 °C/3 mmHg (lit.) |
| Density | 1.406 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 154 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.406 |
| BRN | 2038490 |
| InChI | InChI=1S/C8H7Br/c1-2-7-4-3-5-8(9)6-7/h2-6H,1H2 |
| InChIKey | KQJQPCJDKBKSLV-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(C=C)=C1 |
| CAS DataBase Reference | 2039-86-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-BrC6H4CH=CH2(2039-86-3) |
Description and Uses
1-Bromo-3-vinylbenzene acts as a reagent in the synthesis of methylaminopropiophenones used as a muscle relaxant in rats.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





