PRODUCT Properties
| Melting point: | 27℃ |
| Boiling point: | 105 °C / 12mmHg |
| Density | 1.694±0.06 g/cm3(Predicted) |
| refractive index | 1.59 |
| Flash point: | 27 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Solid |
| pka | 2.13±0.10(Predicted) |
| color | White or Colorless to Yellow to Orange |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H5BrFN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| InChIKey | ADWKOCXRCRSMLQ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Br)=CC=C1F |
| CAS DataBase Reference | 2924-09-6(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-fluoroaniline is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H302-H312-H331-H335 |
| Precautionary statements | P304+P340-P305+P351+P338-P405-P501a-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 22-36-52-36/37/38-20/21/22 |
| Safety Statements | 26-60-36/37-9 |
| RIDADR | 2811 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT, TOXIC |
| HazardClass | 6.1 |
| HS Code | 29214990 |
