A1371612
4-Bromo-2-fluoro-1-nitrobenzene , 98% , 321-23-3
CAS NO.：321-23-3
Empirical Formula: C6H3BrFNO2
Molecular Weight: 220
MDL number: MFCD01930221
EINECS: 628-505-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB196.00 | In Stock |
|
| 100g | RMB756.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-86 |
| Boiling point: | 263.2±20.0 °C(Predicted) |
| Density | 1.375 |
| Flash point: | 86℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| color | Pale yellow to orange |
| InChI | InChI=1S/C6H3BrFNO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H |
| InChIKey | VQCWSOYHHXXWSP-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 321-23-3(CAS DataBase Reference) |
Description and Uses
Building block for fused aromatic and heteroaromatic compounds
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39-27 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
