A2042412
2-Bromo-4-fluoro-5-nitrophenol , 95% , 84478-87-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB81.60 | In Stock |
|
| 5G | RMB247.20 | In Stock |
|
| 25G | RMB883.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-127℃ |
| Boiling point: | 302.4±42.0 °C(Predicted) |
| Density | 1.965±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 6.51±0.24(Predicted) |
| form | Powder |
| color | Brown |
| InChI | InChI=1S/C6H3BrFNO3/c7-3-1-4(8)5(9(11)12)2-6(3)10/h1-2,10H |
| InChIKey | NVNFKCCUJKPLLT-UHFFFAOYSA-N |
| SMILES | C1(O)=CC([N+]([O-])=O)=C(F)C=C1Br |
| CAS DataBase Reference | 84478-87-5(CAS DataBase Reference) |
Description and Uses
2-Bromo-4-fluoro-5-nitrophenol is a polysubstituted phenol derivative that can be used in the synthesis of isoindolinone and thienopyrimidine dione compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| RIDADR | UN2811 |
| HazardClass | 6.1 |
| HS Code | 2908990000 |
