BD0628848
4-Bromo-2-iodo-1-nitrobenzene , 98% , 343864-78-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB234.40 | In Stock |
|
| 5g | RMB821.60 | In Stock |
|
| 10g | RMB1391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C(protect from light) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C6H3BrINO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H |
| InChIKey | VWDMDPDGACOPSR-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(Br)C=C1I |
Description and Uses
4-Bromo-2-iodo-1-nitrobenzene is a derivative compound of Nitrobenzene (N493000), which is used mainly in the production of the chemical precursor aniline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2904990090 |
