A1372612
5-Bromo-2-(trifluoromethyl)pyridine , 98% , 436799-32-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB109.60 | In Stock |
|
| 25G | RMB390.40 | In Stock |
|
| 100G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-46 °C |
| Boiling point: | 68-70°C 10mm |
| Density | 1.707±0.06 g/cm3(Predicted) |
| Flash point: | 174 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -1.80±0.22(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C6H3BrF3N/c7-4-1-2-5(11-3-4)6(8,9)10/h1-3H |
| InChIKey | RPFAUCIXZGMCFN-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 436799-32-5(CAS DataBase Reference) |
Description and Uses
Regioselective C-4 deprotonation with LDA and trapping with carbon dioxide leads to the corresponding C-4 acid.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36/37/39-37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
