BD8217231
5-Bromo-2-(trifluoromethyl)pyrimidine , 96% , 799557-86-1
CAS NO.：799557-86-1
Empirical Formula: C5H2BrF3N2
Molecular Weight: 226.98
MDL number: MFCD09754046
EINECS: 690-872-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB25.60 | In Stock |
|
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB126.40 | In Stock |
|
| 5g | RMB408.00 | In Stock |
|
| 25g | RMB1688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-42° |
| Boiling point: | 139.8±40.0 °C(Predicted) |
| Density | 1.807±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -3.28±0.22(Predicted) |
| form | Crystalline |
| color | White |
| InChI | InChI=1S/C5H2BrF3N2/c6-3-1-10-4(11-2-3)5(7,8)9/h1-2H |
| InChIKey | GIFDWXWNFKZVEI-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC=C(Br)C=N1 |
Description and Uses
5-bromo-2-(trifluoromethyl)pyrimidine was used in the preparation of pyrimidinone compounds as Lp-PLA2 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
