A1573412
5-Bromo-2-methylpyrimidine , >98.0%(GC) , 7752-78-5
CAS NO.:7752-78-5
Empirical Formula: C5H5BrN2
Molecular Weight: 173.01
MDL number: MFCD07375143
EINECS: 691-361-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.80 | In Stock |
|
| 5G | RMB217.60 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 100G | RMB1768.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80.0 to 85.0 °C |
| Boiling point: | 195.2±13.0 °C(Predicted) |
| Density | 1.596±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| pka | 0.46±0.22(Predicted) |
| form | Solid |
| color | Light yellow to Brown |
| λmax | 266nm(EtOH)(lit.) |
| InChI | InChI=1S/C5H5BrN2/c1-4-7-2-5(6)3-8-4/h2-3H,1H3 |
| InChIKey | NEDJTEXNSTUKHW-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(Br)C=N1 |
Description and Uses
5-BROMO-2-METHYL-PYRIMIDINE is a disubstituted pyrimidine derivative with strong insecticidal effects on house flies.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






