A1380612
(3-Bromopropyl)triphenylphosphonium bromide , 98% , 3607-17-8
Synonym(s):
NSC 84074
CAS NO.：3607-17-8
Empirical Formula: C21H21Br2P
Molecular Weight: 464.17
MDL number: MFCD00011866
EINECS: 222-770-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB159.20 | In Stock |
|
| 500g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Methanol |
| form | solid |
| color | White |
| Sensitive | Hygroscopic |
| BRN | 6422974 |
| InChI | InChI=1S/C21H21BrP.BrH/c22-17-10-18-23(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;/h1-9,11-16H,10,17-18H2;1H/q+1;/p-1 |
| InChIKey | ZAHUZZUGJRPGKW-UHFFFAOYSA-M |
| SMILES | [P+](CCCBr)(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Br-] |
| CAS DataBase Reference | 3607-17-8(CAS DataBase Reference) |
Description and Uses
Reactant involved in:
- Synthesis of functionalized polyurethanes using cationic ring-opening polymerization and click chemistry
- Semipinacol rearrangement and direct arylation
- Olefination of benzaldehydes
- C-H activation / cycloisomerization
- Intramolecular dehydrobromination
- Cycloisomerizations of bromodienes and enynes
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 26-37/39-36/37 |
| WGK Germany | 3 |
| HS Code | 29319090 |
