A2575012
(Cyanomethyl)triphenylphosphonium Chloride , >98.0%(HPLC) , 4336-70-3
Synonym(s):
NSC 92174
CAS NO.:4336-70-3
Empirical Formula: C20H17ClNP
Molecular Weight: 337.78
MDL number: MFCD00031672
EINECS: 224-383-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB59.20 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100G | RMB601.60 | In Stock |
|
| 500g | RMB2480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 268-270 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| color | White to Almost white |
| Water Solubility | very faint turbidity |
| Sensitive | Hygroscopic |
| BRN | 6222047 |
| InChI | 1S/C20H17NP.ClH/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-15H,17H2;1H/q+1;/p-1 |
| InChIKey | ARPLQAMUUDIHIT-UHFFFAOYSA-M |
| SMILES | [Cl-].N#CC[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 4336-70-3(CAS DataBase Reference) |
Description and Uses
Reactant involved in:
- Condenation reactions
- Wittig reactions
- Synthesis of phosphonium-iodonium ylides
- Preparation of α,β-unsaturated esters, amides, and nitriles
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H331-H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P501a-P264-P270-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | TA2075000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |








