A1382412
2-Bromo-3′,4′-dichloroacetophenone , >98.0% , 2632-10-2
Synonym(s):
3,4-Dichlorophenacyl bromide
CAS NO.:2632-10-2
Empirical Formula: C8H5BrCl2O
Molecular Weight: 267.93
MDL number: MFCD00051581
EINECS: 627-992-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB89.60 | In Stock |
|
| 25G | RMB312.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54 °C |
| Boiling point: | 339℃ |
| Density | 1.695 |
| Flash point: | 159℃ |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 511981 |
| InChI | InChI=1S/C8H5BrCl2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
| InChIKey | PAKFHEFMTRCFAU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C(Cl)=C1)CBr |
| CAS DataBase Reference | 2632-10-2(CAS DataBase Reference) |
Description and Uses
2-Bromo-3',4'-dichloroacetophenone is a chemical ragent used in the synthesis of 2-aroylbenzoxazoles. As well, it is used in the synthesis of aminoarylthiazole derivatives as correctors of chloride transport defect in cystic fibrosis patients.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xi,T |
| Risk Statements | 20/21/22-34-36/37-36/37/38-36-25 |
| Safety Statements | 26-27-36/37/39-36-45 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |





