A1385612
4-Bromo-3-chlorophenol , 98% , 13631-21-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25g | RMB306.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66°C |
| Boiling point: | 267.5±20.0 °C(Predicted) |
| Density | 1.788±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.43±0.18(Predicted) |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| BRN | 3236445 |
| InChI | InChI=1S/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| InChIKey | FQEYHIPPYOSPLF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C(Cl)=C1 |
| CAS DataBase Reference | 13631-21-5(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-chlorophenol is used as a precursor in organic synthesis to prepare 4-(benzyloxy)-l-bromo-2-chlorobenzene by reaction with benzyl bromide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H335 |
| Precautionary statements | P280h-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HS Code | 2908.19.6000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






