A1390112
2-Bromo-4,5-difluorobenzoic acid , 97% , 64695-84-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB307.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-122 °C (lit.) |
| Boiling point: | 291.3±40.0 °C(Predicted) |
| Density | 1.872±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 2.45±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| InChI | InChI=1S/C7H3BrF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12) |
| InChIKey | DGCBGBZYTNTZJH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C=C1Br |
| CAS DataBase Reference | 64695-84-7(CAS DataBase Reference) |
Description and Uses
2-Bromo-4,5-difluorobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22 |
| Safety Statements | 36-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
