A1538912
2-Bromo-5-nitrobenzoic Acid , >98.0% , 943-14-6
CAS NO.:943-14-6
Empirical Formula: C7H4BrNO4
Molecular Weight: 246.01
MDL number: MFCD00134558
EINECS: 619-009-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB46.40 | In Stock |
|
| 5G | RMB216.80 | In Stock |
|
| 25G | RMB544.80 | In Stock |
|
| 100g | RMB2039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-181 °C (lit.) |
| Boiling point: | 370.5±32.0 °C(Predicted) |
| Density | 2.0176 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Store at room temperature |
| solubility | Chloroform, Methanol |
| form | Powder |
| pka | 2.15±0.10(Predicted) |
| color | Light beige to pale brown |
| BRN | 980242 |
| InChI | InChI=1S/C7H4BrNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | UVFWYVCDRKRAJH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=CC=C1Br |
| CAS DataBase Reference | 943-14-6(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-nitrobenzoic acid may be used in the preparation of 2-bromo-5-nitrobenzophenone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







