A1397112
2-Bromo-5-chloroanisole , >98.0%(GC) , 174913-09-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB276.80 | In Stock |
|
| 100G | RMB927.20 | In Stock |
|
| 500g | RMB3727.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 236.6±20.0 °C(Predicted) |
| Density | 1.564±0.06 g/cm3(Predicted) |
| refractive index | 1.5875 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H6BrClO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,1H3 |
| InChIKey | CQGYLDZGJLVLMK-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Cl)C=C1OC |
Description and Uses
2-Bromo-5-chloroanisole is a kind of anisole compound. Its benzene ring structure formula contains bromine and chlorine functional groups and can be used as a raw material for chemical synthesis or an intermediate for organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| Hazard Note | Irritant |
| HS Code | 29092000 |
