A1449712
2-Bromo-5-chlorobenzoic Acid , ≥98.0%(GC) , 21739-93-5
CAS NO.:21739-93-5
Empirical Formula: C7H4BrClO2
Molecular Weight: 235.46
MDL number: MFCD00013982
EINECS: 244-559-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB80.00 | In Stock |
|
| 100G | RMB274.40 | In Stock |
|
| 500g | RMB999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-157 °C |
| Boiling point: | 318.8±27.0 °C(Predicted) |
| Density | 1.809±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 2.48±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 2442261 |
| InChI | InChI=1S/C7H4BrClO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | RBCPJQQJBAQSOU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=CC=C1Br |
| CAS DataBase Reference | 21739-93-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-5-chlorobenzoic acid(21739-93-5) |
Description and Uses
2-Bromo-5-chlorobenzoic acid could be used to synthesis 6-Chloro-2-methylquinazolin-4(3H)-one and 2-Amino-5-chlorobenzoic Acid.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H400 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |








