A1408212
BMN 673 , ≥98% , 1207456-01-6
CAS NO.:1207456-01-6
Empirical Formula: C19H14F2N6O
Molecular Weight: 380.35
MDL number: MFCD22666357
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB1098.40 | In Stock |
|
| 50MG | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247 - 249°C |
| Density | 1.63 |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.14±0.60(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C19H14F2N6O/c1-27-18(22-8-23-27)15-16(9-2-4-10(20)5-3-9)24-13-7-11(21)6-12-14(13)17(15)25-26-19(12)28/h2-8,15-16,24H,1H3,(H,26,28)/t15-,16-/m1/s1 |
| InChIKey | HWGQMRYQVZSGDQ-HZPDHXFCSA-N |
| SMILES | C1(=O)C2=C3C(N[C@H](C4=CC=C(F)C=C4)[C@@H](C4N(C)N=CN=4)C3=NN1)=CC(F)=C2 |
Description and Uses
BMN 673 is a pyrrolopyrazine derivative and anpoly (ADP-ribose) polymerase (PARP) inhibitor for patients with advanced or recurrent solid tumors such as ovarian and breast cancer.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360-H372-H341 |
| Precautionary statements | P260-P264-P270-P314-P501-P201-P202-P281-P308+P313-P405-P501 |






