A1410212
4-Bromo-2-hydroxypyridine , ≥97.0% , 36953-37-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB80.00 | In Stock |
|
| 5G | RMB223.20 | In Stock |
|
| 25G | RMB657.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186 °C |
| Boiling point: | 305.9±42.0 °C(Predicted) |
| Density | 1.776±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 10.54±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| InChI | InChI=1S/C5H4BrNO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8) |
| InChIKey | SSLMGOKTIUIZLY-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC(Br)=C1 |
| CAS DataBase Reference | 36953-37-4(CAS DataBase Reference) |
Description and Uses
4-Bromo-2-hydroxypyridine is used as a reagent to synthesize trans-3,4’-bispyridinylethylenes, compounds that act as inhibitors of protein kinase B that are used to treat cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| Risk Statements | 36/38 |
| Safety Statements | 36 |
| Hazard Note | Harmful |
| HS Code | 29333990 |
