A1414812
(-)-Blebbistatin , ≥98% , 856925-71-8
Synonym(s):
(-)-Blebbistatin - CAS 856925-71-8 - Calbiochem;1-Phenyl-1,2,3,4-tetrahydro-4-hydroxypyrrolo[2.3-b]-7-methylquinolin-4-one
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB135.20 | In Stock |
|
| 5mg | RMB479.20 | In Stock |
|
| 10MG | RMB799.20 | In Stock |
|
| 50MG | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212°C |
| Boiling point: | 507.3±60.0 °C(Predicted) |
| Density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: soluble5mg/mL |
| form | Yellow solid |
| pka | 11.15±0.20(Predicted) |
| color | Light Yellow to Yellow |
| InChI | 1S/C18H16N2O2/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13/h2-8,11,22H,9-10H2,1H3/t18-/m1/s1 |
| InChIKey | LZAXPYOBKSJSEX-GOSISDBHSA-N |
| SMILES | Cc1ccc2N=C3N(CC[C@@]3(O)C(=O)c2c1)c4ccccc4 |
Description and Uses
Blebbistatin blocked myosin II-dependent cell processes. It blocks cell blebbing rapidly and reversibly. Also rapidly disrupted directed cell migration and cytokinesis in vertebrate cell. It blocks both blebbing and cytokinesis at 50-100μM. [a]D= -103
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H317-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |





