A1422512
4′-Bromo-2,2,2-trifluoroacetophenone , ≥98% , 16184-89-7
Synonym(s):
4-Bromo-α,α,α-trifluoroacetophenone
CAS NO.：16184-89-7
Empirical Formula: C8H4BrF3O
Molecular Weight: 253.02
MDL number: MFCD00191862
EINECS: 629-304-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25g | RMB300.00 | In Stock |
|
| 100g | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-30 °C(lit.) |
| Boiling point: | 95 °C4 mm Hg(lit.) |
| Density | 1.662 g/mL at 25 °C(lit.) |
| refractive index | 1.4610 (estimate) |
| Flash point: | 205 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | low melting crystals |
| color | Colourless |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 1956460 |
| InChI | InChI=1S/C8H4BrF3O/c9-6-3-1-5(2-4-6)7(13)8(10,11)12/h1-4H |
| InChIKey | IHGSAQHSAGRWNI-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Br)C=C1)C(F)(F)F |
| CAS DataBase Reference | 16184-89-7 |
Description and Uses
4?-Bromo-2,2,2-trifluoroacetophenone may be used in the preparation of carbonyl-bridged bithiazole derivatives. Also used as a reagent to synthesize MK-5046, a selective Bombesin receptor subtype-3 agonist used to treat obesity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
