A1423212
4'-Bromo-3'-nitroacetophenone , 99% , 18640-58-9
CAS NO.:18640-58-9
Empirical Formula: C8H6BrNO3
Molecular Weight: 244.04
MDL number: MFCD00016985
EINECS: 242-469-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB95.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-121 °C(lit.) |
| Boiling point: | 275.4℃ |
| Density | 1.637 |
| refractive index | 1.6090 (estimate) |
| Flash point: | 120.4℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Amorphous Powder |
| color | White to slightly yellow |
| BRN | 2050098 |
| InChI | InChI=1S/C8H6BrNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 |
| InChIKey | YFVOFFKNHQTQQE-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Br)C([N+]([O-])=O)=C1)C |
| CAS DataBase Reference | 18640-58-9(CAS DataBase Reference) |
Description and Uses
4′-Bromo-3′-nitroacetophenone is an electron deficient acetophenone derivative.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |






