A1433912
1-Bromo-2-methylnaphthalene , ≥90.0%(GC) , 2586-62-1
CAS NO.：2586-62-1
Empirical Formula: C11H9Br
Molecular Weight: 221.09
MDL number: MFCD00003871
EINECS: 219-966-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB61.60 | In Stock |
|
| 10G | RMB100.80 | In Stock |
|
| 25G | RMB180.00 | In Stock |
|
| 50G | RMB343.20 | In Stock |
|
| 100G | RMB608.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 296 °C (lit.) |
| Density | 1.418 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear yellow |
| Water Solubility | Not miscible in water. |
| BRN | 2042531 |
| InChI | InChI=1S/C11H9Br/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,1H3 |
| InChIKey | CMIMBQIBIZZZHQ-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1C |
| CAS DataBase Reference | 2586-62-1(CAS DataBase Reference) |
Description and Uses
1-Bromo-2-methylnaphthalene was used as test compound in determination of halogenated hydrocarbons at trace levels by supercritical fluid chromatography-microwave-induced plasma mass spectrometry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-11 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29039990 |
