A1497612
1-Bromo-2-naphthaldehyde , >96.0% , 3378-82-3
CAS NO.:3378-82-3
Empirical Formula: C11H7BrO
Molecular Weight: 235.08
MDL number: MFCD00046368
EINECS: 222-180-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1G | RMB52.80 | In Stock |
|
| 5G | RMB186.40 | In Stock |
|
| 10g | RMB460.00 | In Stock |
|
| 25G | RMB635.20 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| 500g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118°C |
| Boiling point: | 347℃ |
| Density | 1.552 |
| Flash point: | 120℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | crystals |
| Appearance | Off-white to yellow Solid |
| BRN | 2613639 |
| InChI | InChI=1S/C11H7BrO/c12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-7H |
| InChIKey | CYGUXEZVBLMVRV-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1C=O |
| CAS DataBase Reference | 3378-82-3(CAS DataBase Reference) |
Description and Uses
1-Bromo-2-naphthaldehyde is used as a reagent in the synthesis of Hoveyda-Grubbs type metathesis catalysts which are used in cross olefin metathesis. 1-Bromo-2-naphthaldehyde is also used in the preparation of novel (-)-cercosporamide derivatives as potent selective PPARγ modulators.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






