A1436612
4-Bromophenylacetone , 98% , 6186-22-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB81.60 | In Stock |
|
| 5G | RMB230.40 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| 100G | RMB3075.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24-25 °C |
| Boiling point: | 139°C/11mmHg(lit.) |
| Density | 1.3841 (rough estimate) |
| refractive index | 1.5560 to 1.5600 |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid After Melting |
| color | Clear yellow |
| Water Solubility | Miscible with chloroform and dichloromethane. Slightly miscible with water. |
| InChI | InChI=1S/C9H9BrO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3 |
| InChIKey | CFMMTXJMIJRUSH-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)C(=O)C |
| CAS DataBase Reference | 6186-22-7(CAS DataBase Reference) |
Description and Uses
4-Bromophenylacetone is used to prepare biphenyl-4-yl-acetone by reacting with phenylboronic acid using cesium fluoride as a reagent and palladium phosphine complex as a catalyst.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P501-P210-P280-P370+P378-P403+P235 |
| Safety Statements | 24/25 |
| HS Code | 29143900 |
