A1441212
4-bromo-2-nitrophenol , ≥98.0%(GC) , 7693-52-9
CAS NO.:7693-52-9
Empirical Formula: C6H4BrNO3
Molecular Weight: 218
MDL number: MFCD00082540
EINECS: 231-707-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB211.20 | In Stock |
|
| 100g | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-94 °C (lit.) |
| Boiling point: | 259.4±20.0 °C(Predicted) |
| Density | 1.8994 (rough estimate) |
| refractive index | 1.6090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.28±0.14(Predicted) |
| form | Crystalline Powder or Crystals |
| color | Yellow |
| Water Solubility | Slightly soluble |
| InChI | InChI=1S/C6H4BrNO3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H |
| InChIKey | CUTFAPGINUFNQM-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 7693-52-9(CAS DataBase Reference) |
Description and Uses
4-bromo-2-nitrophenol is an essential intermediate for fine chemical engineering. It can be used to synthesize derivatives with biological activity, such as heterocyclic compounds as peptidase inhibitors for treating diabetes, introducing fluorine-containing groups as pesticides, and aminic compounds as Btk inhibitors for treating immune diseases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P301+P312-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-20/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| RTECS | SJ8370000 |
| Hazard Note | Harmful |
| HS Code | 29089990 |



