A1444250
4,4-Azodianiline , ≥98% , 538-41-0
CAS NO.:538-41-0
Empirical Formula: C12H12N4
Molecular Weight: 212.25
MDL number: MFCD00041892
EINECS: 208-690-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB151.20 | In Stock |
|
| 1g | RMB314.40 | In Stock |
|
| 5g | RMB1197.60 | In Stock |
|
| 25g | RMB2339.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245 °C |
| Boiling point: | 342.09°C (rough estimate) |
| Density | 1.2046 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | Powder |
| pka | 3.70±0.10(Predicted) |
| color | Brown |
| Water Solubility | Very soluble in ethanol. Insoluble in water. |
| Merck | 14,2977 |
| BRN | 745553 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C12H12N4/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
| InChIKey | KQIKKETXZQDHGE-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(N)C=C1)=NC1=CC=C(N)C=C1 |
| EPA Substance Registry System | Benzenamine, 4,4'-azobis- (538-41-0) |
Description and Uses
4,4'-Diaminoazobenzene is used in cross-linking studies of epoxy resins and the synthesis of surface relief holographic materials. It is used in synthesis of anthraquinone reactive dyes.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310a-P321-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 40-25 |
| Safety Statements | 45-28A |
| RIDADR | 2811 |
| RTECS | BW7450000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29270000 |
| Toxicity | LD50 intravenous in mouse: 180mg/kg |







