T7614930
4-Amino-4'-dimethylaminoazobenzene , >97.0%(T)(HPLC) , 539-17-3
Synonym(s):
p,p′-Dimapa-aniline;p,p′-DMPA-aniline;4-(4-Dimethylaminophenylazo)aniline;4-Amino-4′-(dimethylamino)azobenzene;4-Amino-4′-dimethylaminoazobenzene
CAS NO.:539-17-3
Empirical Formula: C14H16N4
Molecular Weight: 240.3
MDL number: MFCD00010204
EINECS: 208-712-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB748.00 | In Stock |
|
| 5g | RMB2392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-195 °C (dec.) |
| Boiling point: | 373.02°C (rough estimate) |
| Density | 1.0236 (rough estimate) |
| refractive index | 1.4850 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.43±0.10(Predicted) |
| form | powder to crystal |
| color | Yellow to Amber to Dark red |
| Water Solubility | 120.2ug/L(25 ºC) |
| BRN | 748253 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H16N4/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,15H2,1-2H3/b17-16+ |
| InChIKey | BVRIUXYMUSKBHG-WUKNDPDISA-N |
| SMILES | CN(C)c1ccc(cc1)\N=N\c2ccc(N)cc2 |
| CAS DataBase Reference | 539-17-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4-[(4-aminophenyl)azo]-N,N-dimethyl- (539-17-3) |
Description and Uses
N,N-Dimethyl-4,4''-azodianiline is a disperse dye. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BX5020000 |
| F | 8-9-23 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![2-[N-(2-Cyanoethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]anilino]ethyl acetate](https://img.chemicalbook.com/CAS/GIF/5261-31-4.gif)
