A1452412
1,2-Bis(trimethoxysilyl)ethane , ≥97.0%(GC) , 18406-41-2
Synonym(s):
1,2-Bis(trimethoxysilyl)ethane;1,2-Ethylenebis(trimethoxysilane)
CAS NO.：18406-41-2
Empirical Formula: C8H22O6Si2
Molecular Weight: 270.43
MDL number: MFCD00053672
EINECS: 242-285-6
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB111.20 | In Stock |
|
| 25ML | RMB455.20 | In Stock |
|
| 100ML | RMB1279.20 | In Stock |
|
| 500ml | RMB1666.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 103-104 °C5 mm Hg(lit.) |
| Density | 1.073 g/mL at 25 °C(lit.) |
| vapor pressure | 1.2Pa at 20℃ |
| refractive index | n |
| Flash point: | 228 °F |
| form | Liquid |
| Specific Gravity | 1.09 |
| color | Colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C8H22O6Si2/c1-9-15(10-2,11-3)7-8-16(12-4,13-5)14-6/h7-8H2,1-6H3 |
| InChIKey | JCGDCINCKDQXDX-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(OC)CC[Si](OC)(OC)OC |
| LogP | -1.68 at 25℃ |
| CAS DataBase Reference | 18406-41-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2,7-Dioxa-3,6-disilaoctane, 3,3,6,6-tetramethoxy- (18406-41-2) |
Description and Uses
3,3,6,6-Tetramethoxy-2,7-dioxa-3,6-disilaoctane is useful in the preparation of functionalized periodic mesoporous organosilicas for selective adsorption of proteins.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H330 |
| Precautionary statements | P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+ |
| Risk Statements | 26 |
| Safety Statements | 23-36/37-45 |
| RIDADR | UN 3382 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | JG7873000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 29319090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation |
