A7857312
Triacetoxy(methyl)silane , ≥55%(GC) , 4253-34-3
Synonym(s):
Methyltriacetoxysilane
CAS NO.:4253-34-3
Empirical Formula: C7H12O6Si
Molecular Weight: 220.25
MDL number: MFCD00008694
EINECS: 224-221-9
| Pack Size | Price | Stock | Quantity |
| 500ML | RMB79.20 | In Stock |
|
| 2.5L | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-45 °C(lit.) |
| Boiling point: | 94-95 °C9 mm Hg(lit.) |
| Density | 1.20 g/mL at 20 °C(lit.) |
| vapor pressure | 0.053-26Pa at 20-25℃ |
| refractive index | 1.52-1.522 |
| Flash point: | 185 °F |
| solubility | soluble in Methanol |
| form | solid |
| Specific Gravity | 1.175 |
| color | White or Colorless to Almost white or Almost colorless |
| Odor | Acrid odor |
| Water Solubility | 1000g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1788668 |
| InChI | 1S/C7H12O6Si/c1-5(8)11-14(4,12-6(2)9)13-7(3)10/h1-4H3 |
| InChIKey | TVJPBVNWVPUZBM-UHFFFAOYSA-N |
| SMILES | CC(=O)O[Si](C)(OC(C)=O)OC(C)=O |
| LogP | -2.4 at 20℃ |
| CAS DataBase Reference | 4253-34-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyltriacetoxysilane(4253-34-3) |
| EPA Substance Registry System | Silanetriol, 1-methyl-, 1,1,1-triacetate (4253-34-3) |
Description and Uses
Methyltriacetoxysilane is used as a silane coupling agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P280-P301+P312+P330-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN1759 |
| WGK Germany | 2 |
| RTECS | VV4500000 |
| F | 9-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |








