A1471512
2,6-Bis[(3aS,8aR)-3a,8a-dihydro-8H-indeno[1,2-d]oxazolin-2-yl]pyridine , 185346-09-2
Synonym(s):
(3aS,3′aS,8aR,8′aR)-2,2′-(2,6-Pyridinediyl)bis[3a,8a-dihydro-8H-indeno[1,2-d]oxazole;(3aS,8aR)-in-pybox
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB690.24 | In Stock |
|
| 1G | RMB1726.88 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265°C (dec.) |
| Boiling point: | 633.0±55.0 °C(Predicted) |
| alpha | -364.0° (c 1.04, CH2Cl2) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.35±0.20(Predicted) |
| form | Powder |
| color | white to off-white |
| optical activity | [α]20/D -375°, c = 1 in dichloromethane (typical) |
| InChI | 1S/C25H19N3O2/c1-3-8-16-14(6-1)12-20-22(16)27-24(29-20)18-10-5-11-19(26-18)25-28-23-17-9-4-2-7-15(17)13-21(23)30-25/h1-11,20-23H,12-13H2/t20-,21-,22+,23+/m1/s1 |
| InChIKey | BZSJUFJXCHHRHW-LUKWVAJMSA-N |
| SMILES | C1(C2=N[C@@]3([H])C4=C(C=CC=C4)C[C@@]3([H])O2)=NC(C2=N[C@@]3([H])C4=C(C=CC=C4)C[C@@]3([H])O2)=CC=C1 |
Description and Uses
Reactant involved in synthesis of:
- Chiral ruthenium(II)-pybox complexes for use as intramolecular C-H amination catalysts
- Bis(oxazolinyl_pyridine-scandium(III) triflate complex catalyst for enantioselective addition of pyrroles to indoles
- Chiral N,N,N-tridentate pybos and pyboxazine ligands
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |

![2,6-Bis[(3aS,8aR)-3a,8a-dihydro-8H-indeno[1,2-d]oxazolin-2-yl]pyridine](https://img.chemicalbook.com/CAS/GIF/185346-09-2.gif)

![2,6-Bis[(4S)-4-phenyl-2-oxazolinyl]pyridine](https://img.chemicalbook.com/CAS/GIF/174500-20-0.gif)



