A5274412
(S,S)-2,2'-Isopropylidenebis(4-phenyl-2-oxazoline) , 97% , 131457-46-0
Synonym(s):
(S,S)-2,2′-Isopropylidenebis(4-phenyl-2-oxazoline);(S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB436.00 | In Stock |
|
| 1G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-41 °C(lit.) |
| alpha | -150 º (C=1% IN ETOH) |
| Boiling point: | 193 °C0.03 mm Hg(lit.) |
| Density | 1 g/mL at 25 °C(lit.) |
| refractive index | -155 ° (C=1, EtOH) |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| form | liquid |
| pka | 4.85±0.70(Predicted) |
| Appearance | Off-white to light yellow <37°C Solid,>41°C Liquid |
| optical activity | [α]20/D 160°, c = 1 in ethanol |
| BRN | 4266906 |
| InChI | InChI=1S/C21H22N2O2/c1-21(2,19-22-17(13-24-19)15-9-5-3-6-10-15)20-23-18(14-25-20)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | JTNVCJCSECAMLD-QZTJIDSGSA-N |
| SMILES | C(C1=N[C@@H](C2=CC=CC=C2)CO1)(C1=N[C@@H](C2=CC=CC=C2)CO1)(C)C |
Description and Uses
C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |




![2,6-Bis[(3aR,8aS)-(+)-8H-indeno[1,2-d]oxazolin-2-yl)pyridine](https://img.chemicalbook.com/CAS/GIF/357209-32-6.gif)

![(+)-2,2′-Isopropylidenebis[(4<I>R</I>)-4-benzyl-2-oxazoline]](https://img.chemicalbook.com/CAS/GIF/141362-77-8.gif)
