BD2900745
1,2-Bis((2R,5R)-2,5-diphenylphospholan-1-yl)ethane , 98% , 528565-79-9
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB574.40 | In Stock |
|
| 100mg | RMB803.20 | In Stock |
|
| 250mg | RMB1204.80 | In Stock |
|
| 1g | RMB3011.20 | In Stock |
|
| 5g | RMB10538.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144°C |
| alpha | -182.7° (c 1.0, CH2Cl2) |
| Boiling point: | 654.2±55.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| color | white |
| Water Solubility | Sparingly soluble in water.(3.2E-5g/L) (25°C |
| Sensitive | Air Sensitive |
| InChIKey | VHHAZLMVLLIMHT-YFRBGRBWSA-N |
| SMILES | C(P1[C@@H](C2=CC=CC=C2)CC[C@@H]1C1=CC=CC=C1)CP1[C@@H](C2=CC=CC=C2)CC[C@@H]1C1=CC=CC=C1 |
Description and Uses
It is used as ligands like DuPhos and BPE ligands and are highly efficient privileged ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |






![2,6-Bis[(3aS,8aR)-3a,8a-dihydro-8H-indeno[1,2-d]oxazolin-2-yl]pyridine](https://img.chemicalbook.com/CAS/GIF/185346-09-2.gif)
![2,6-Bis[(4S)-4-phenyl-2-oxazolinyl]pyridine](https://img.chemicalbook.com/CAS/GIF/174500-20-0.gif)