BD2942745
(4S,4'S)-(-)-22'-(3-PEntylidene)bis(4-isopropyloxazoline) , 97% , 160191-65-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB201.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120 °C/0.001 mmHg (lit.) |
| Density | 1.002 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 180 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 5.51±0.70(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | -112.905°(C=1g/100ml CHCL3) |
| InChI | 1S/C17H30N2O2/c1-7-17(8-2,15-18-13(9-20-15)11(3)4)16-19-14(10-21-16)12(5)6/h11-14H,7-10H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | PIJFQTUSLZLNOP-ZIAGYGMSSA-N |
| SMILES | CCC(CC)(C1=N[C@H](CO1)C(C)C)C2=N[C@H](CO2)C(C)C |
Description and Uses
(4S,4′S)-(?)-2,2′-(3-Pentylidene)bis(4-isopropyloxazoline) is a bisoxazoline that can be used as a ligand:
- To prepare [11C]carboxylic acids, [11C]esters and [11C]amides using boronic acid esters and 11CO2.
- In one of the key synthetic steps for the total synthesis of tatanan A and 3-epi-tatanan A.
- To prepare copper(I) complex and used in a mass spectrometric method to study its chiral selectivity with different substrates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![2,6-Bis[(3aR,8aS)-(+)-8H-indeno[1,2-d]oxazolin-2-yl)pyridine](https://img.chemicalbook.com/CAS/GIF/357209-32-6.gif)

![(+)-2,2′-Isopropylidenebis[(4<I>R</I>)-4-benzyl-2-oxazoline]](https://img.chemicalbook.com/CAS/GIF/141362-77-8.gif)
![(+)-2,2′-Isopropylidenebis[(4R)-4-phenyl-2-oxazoline]](https://img.chemicalbook.com/CAS/GIF/150529-93-4.gif)