A1475612
2-Bromo-4,6-dimethylaniline , ≥97.0%(GC) , 41825-73-4
CAS NO.:41825-73-4
Empirical Formula: C8H10BrN
Molecular Weight: 200.08
MDL number: MFCD00047826
EINECS: 609-959-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB104.80 | In Stock |
|
| 25G | RMB484.80 | In Stock |
|
| 100G | RMB1824.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-47 °C (lit.) |
| Boiling point: | 75-79°C 5mm |
| Density | 1.424 |
| refractive index | 1.5748 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.82±0.10(Predicted) |
| form | powder to crystal |
| color | Amber to Dark green to Black |
| Water Solubility | Insoluble in water. |
| BRN | 3046484 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| InChIKey | YOSJCQJJIHEUKA-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(C)C=C1Br |
| CAS DataBase Reference | 41825-73-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Bromo-4,6-dimethylaniline (41825-73-4) |
Description and Uses
2-Bromo-4,6-dimethylaniline can react with 3-chloro-3-methyl-but-1-yne to produce 2-bromo-N-(1',1'-dimethylprop-2'-ynyl)-4,6-dimethylaniline. This reaction will need reagent Et3N, catalyst CuCl, and the menstruum dioxane.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






