A8403412
2-Amino-3-bromo-5-methylbenzoic acid , 98% , 13091-43-5
CAS NO.:13091-43-5
Empirical Formula: C8H8BrNO2
Molecular Weight: 230.06
MDL number: MFCD00051705
EINECS: 625-729-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB83.20 | In Stock |
|
| 5G | RMB267.20 | In Stock |
|
| 25G | RMB969.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-208 °C (lit.) |
| Boiling point: | 350.2±42.0 °C(Predicted) |
| Density | 1.682±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystalline |
| pka | 4.62±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 3540992 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H8BrNO2/c1-4-2-5(8(11)12)7(10)6(9)3-4/h2-3H,10H2,1H3,(H,11,12) |
| InChIKey | LCMZECCEEOQWLQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C)=CC(Br)=C1N |
| CAS DataBase Reference | 13091-43-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43 |
| Safety Statements | 37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |







