A1479012
2-Bromoacetamide , ≥98.0%(GC) , 683-57-8
CAS NO.：683-57-8
Empirical Formula: C2H4BrNO
Molecular Weight: 137.96
MDL number: MFCD00008025
EINECS: 614-427-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100g | RMB575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-91 °C(lit.) |
| Boiling point: | 271.6±23.0 °C(Predicted) |
| Density | 1.4243 (rough estimate) |
| refractive index | 1.4740 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 160g/l |
| pka | 14.79±0.40(Predicted) |
| form | Crystalline Powder |
| color | White |
| BRN | 1739073 |
| InChI | InChI=1S/C2H4BrNO/c3-1-2(4)5/h1H2,(H2,4,5) |
| InChIKey | JUIKUQOUMZUFQT-UHFFFAOYSA-N |
| SMILES | C(N)(=O)CBr |
| CAS DataBase Reference | 683-57-8(CAS DataBase Reference) |
Description and Uses
2-Bromoacetamide was used in preparation of (2-carbamoylmethoxy-5-chloro-benzyl)-carbamic acid tert-butyl ester. It was aslo used as precursor to dehydropeptidase I inactivator.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T,C |
| Risk Statements | 25-34-20/21/22 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 2923 8/PG 2 |
| WGK Germany | 3 |
| RTECS | AB4587000 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29241990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
