A1514512
4,4'-Biphenyldicarbonyl Chloride , >97.0%(GC)(T) , 2351-37-3
CAS NO.:2351-37-3
Empirical Formula: C14H8Cl2O2
Molecular Weight: 279.12
MDL number: MFCD00058934
EINECS: 219-085-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB158.40 | In Stock |
|
| 5G | RMB608.00 | In Stock |
|
| 10G | RMB1106.40 | In Stock |
|
| 25G | RMB1441.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189 °C |
| Boiling point: | 407.8±38.0 °C(Predicted) |
| Density | 1.344 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | very faint turbidity in hot Toluene |
| form | powder to crystaline |
| color | White to Orange to Green |
| InChI | InChI=1S/C14H8Cl2O2/c15-13(17)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(16)18/h1-8H |
| InChIKey | QDBOAKPEXMMQFO-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C(Cl)=O)C=C2)=CC=C(C(Cl)=O)C=C1 |
| EPA Substance Registry System | [1,1'-Biphenyl]-4,4'-dicarbonyl dichloride (2351-37-3) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | 36-38-50/53 |
| Safety Statements | 26-60-61 |
| RIDADR | 3261 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2902900000 |




![4'-Methyl-[1,1'-biphenyl]-4-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/36393-42-7.gif)

