A1520612
Benzyl 4-Hydroxyphenyl Ketone , 98.0% , 2491-32-9
Synonym(s):
4′-Hydroxy-2-phenylacetophenone;4′-Hydroxydeoxybenzoin
CAS NO.：2491-32-9
Empirical Formula: C14H12O2
Molecular Weight: 212.24
MDL number: MFCD00002360
EINECS: 219-654-5
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB79.20 | In Stock |
|
| 1G | RMB310.40 | In Stock |
|
| 5G | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-151 °C (lit.) |
| Boiling point: | 403.3±20.0 °C(Predicted) |
| Density | 1.178±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.12±0.15(Predicted) |
| color | White to Orange to Green |
| InChI | 1S/C14H12O2/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9,15H,10H2 |
| InChIKey | JBQTZLNCDIFCCO-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(=O)Cc2ccccc2 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
