A1526112
Biphenyl-4-carboxylic Hydrazide , >97.0% , 18622-23-6
CAS NO.：18622-23-6
Empirical Formula: C13H12N2O
Molecular Weight: 212.25
MDL number: MFCD00017078
EINECS: 242-451-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB28.00 | In Stock |
|
| 1G | RMB37.60 | In Stock |
|
| 5g | RMB131.20 | In Stock |
|
| 25g | RMB559.20 | In Stock |
|
| 100g | RMB2130.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-193°C |
| Density | 1.164±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 12.55±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1106894 |
| InChI | InChI=1S/C13H12N2O/c14-15-13(16)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,14H2,(H,15,16) |
| InChIKey | QEUAQXSDDNDOTG-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(C(NN)=O)C=C1 |
| CAS DataBase Reference | 18622-23-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| HS Code | 2928.00.2500 |
| HazardClass | IRRITANT |
![[1,1'-Biphenyl]-2-carbohydrazide](https://img.chemicalbook.com/CAS/GIF/154660-48-7.gif)
