A1538812
4-Bromo-2-nitrobenzoic Acid , >98.0%(T) , 99277-71-1
CAS NO.:99277-71-1
Empirical Formula: C7H4BrNO4
Molecular Weight: 246.01
MDL number: MFCD01013599
EINECS: 627-797-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB49.60 | In Stock |
|
| 25G | RMB183.20 | In Stock |
|
| 100G | RMB1551.20 | In Stock |
|
| 500g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-169 °C |
| Boiling point: | 368.6±32.0 °C(Predicted) |
| Density | 1.892±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 1.97±0.25(Predicted) |
| color | White to Gray to Brown |
| InChI | 1S/C7H4BrNO4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11) |
| InChIKey | ZIRHHEZLJGORGU-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Br)cc1[N+]([O-])=O |
| CAS DataBase Reference | 99277-71-1(CAS DataBase Reference) |
Description and Uses
Undergoes Negishi-type coupling with dimethylzinc in the presence of palladium-phosphine catalysis.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-36/37/38-43-50 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |







