A1553750
TauroursodeoxycholateSodium , 98% , 35807-85-3
Synonym(s):
3α,7β-Dihydroxy-5β-cholan-24-oic acid N-(2-sulfoethyl)amide;Tauroursodeoxycholic acid sodium salt
CAS NO.：35807-85-3
Empirical Formula: C26H44NNaO6S
Molecular Weight: 521.69
MDL number: MFCD00065451
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB95.20 | In Stock |
|
| 1g | RMB319.20 | In Stock |
|
| 5g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-175°C |
| alpha | +40～+50°(D/20℃) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly, Heated), Ethanol (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| Water Solubility | water: 100mg/mL |
| InChIKey | WSSCRQYICWZEFG-SXXADWEANA-N |
| SMILES | C[C@]12CC[C@]3([H])[C@]4(CC[C@@H](O)C[C@@]4([H])C[C@H](O)[C@@]3([H])[C@]1([H])CC[C@]2([H])[C@H](C)CCC(=O)NCCS(O)(=O)=O)C.[NaH] |&1:1,4,6,9,12,15,17,19,23,25,r| |
Description and Uses
Tauroursodeoxycholate inhibits human cholangiocarcinoma growth via Ca2+-, PKC-, and MAPK-dependent pathways.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | 2 |
| RTECS | KI7372500 |
| HS Code | 2924297099 |
