A1568512
4-Bromo-2,5-difluoroaniline , >98.0%(HPLC) , 112279-60-4
CAS NO.:112279-60-4
Empirical Formula: C6H4BrF2N
Molecular Weight: 208
MDL number: MFCD01861125
EINECS: 625-718-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB73.60 | In Stock |
|
| 10g | RMB135.20 | In Stock |
|
| 25g | RMB216.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-78 °C (lit.) |
| Boiling point: | 212.1±35.0 °C(Predicted) |
| Density | 1.788±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.48±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 4741102 |
| InChI | InChI=1S/C6H4BrF2N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2 |
| InChIKey | XOYHFIQPPOJMFK-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=C(Br)C=C1F |
| CAS DataBase Reference | 112279-60-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 28-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






