A1581212
2-(4-Bromophenyl)benzothiazole , >98.0%(HPLC) , 19654-19-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5G | RMB128.00 | In Stock |
|
| 25G | RMB435.20 | In Stock |
|
| 100g | RMB1524.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134 °C |
| Boiling point: | 398℃ |
| Density | 1.545 |
| Flash point: | 194℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 0.29±0.10(Predicted) |
| color | White to Light yellow to Green |
| InChI | InChI=1S/C13H8BrNS/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H |
| InChIKey | FQIRBKKYMJKENC-UHFFFAOYSA-N |
| SMILES | S1C2=CC=CC=C2N=C1C1=CC=C(Br)C=C1 |
Description and Uses
2-(4-Bromophenyl)benzothiazole is a useful research chemical.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H413 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2934.10.2000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





