A1586650
Tetrakis(dimethylamino)tin(IV) , 99.9%tracemetalsbasis , 1066-77-9
Synonym(s):
Tin(IV) dimethylamide
| Pack Size | Price | Stock | Quantity |
| 1g | RMB392.00 | In Stock |
|
| 5g | RMB1199.20 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 53-55 °C (0.1 mmHg) |
| Density | 1.17 |
| Flash point: | -7 °C |
| form | liquid |
| pka | 3.60±0.70(Predicted) |
| color | colorless to pale-yellow |
| Specific Gravity | 1.169 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | moisture sensitive |
| InChI | InChI=1S/4C2H6N.Sn/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | WHXTVQNIFGXMSB-UHFFFAOYSA-N |
| SMILES | [Sn](N(C)C)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 1066-77-9 |
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H314 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T-F,C,F |
| Risk Statements | 41-36/37/38-23/24/25-11-34-20/21/22 |
| Safety Statements | 36/37/39-26-16-45 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 3, 8 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
