S172479
Tetrakis(dimethylamido)zirconium(IV) , electronicgrade,≥99.99%tracemetalsbasis , 19756-04-8
Synonym(s):
TDMAZ;Tetrakis(dimethylamino)zirconium(IV)
CAS NO.：19756-04-8
Empirical Formula: C8H24N4Zr
Molecular Weight: 267.53
MDL number: MFCD00239502
EINECS: 629-068-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB888.68 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-60 °C(lit.) |
| Boiling point: | 80°C 0,1mm |
| Flash point: | >65℃ |
| storage temp. | 2-8°C |
| form | solid |
| Sensitive | moisture sensitive, store cold |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | InChI=1S/4C2H6N.Zr/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | DWCMDRNGBIZOQL-UHFFFAOYSA-N |
| SMILES | [Zr](N(C)C)(N(C)C)(N(C)C)N(C)C |
Description and Uses
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H261-H315-H319-H335 |
| Precautionary statements | P210-P231+P232-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-14/15-36/37/38 |
| Safety Statements | 16-26-36-43 |
| RIDADR | UN 3396 4.3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 4.3, 4.1 |
| HS Code | 29310099 |
| Limited Quantities | 0.5 Kg (1.1 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
